About 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate
3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate (PubChem CID 134896459) has the molecular formula C9H16O2S2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate.
Molecular Properties
| Compound Name | 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate |
| PubChem CID | 134896459 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate |
| SMILES | CC(=O)OCCCC1(C)SCCS1 |
| InChI | InChI=1S/C9H16O2S2/c1-8(10)11-5-3-4-9(2)12-6-7-13-9/h3-7H2,1-2H3 |
| InChIKey | YQJGIGAEEDXTPT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate?
The IUPAC name of 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate (CID 134896459) is 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate.
What is the SMILES notation for 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate?
The canonical SMILES for 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate is CC(=O)OCCCC1(C)SCCS1.
What is the InChIKey of 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate?
The InChIKey is YQJGIGAEEDXTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2S2/c1-8(10)11-5-3-4-9(2)12-6-7-13-9/h3-7H2,1-2H3.
What are the key properties of 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate?
3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate has a molecular weight of 220.36 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-dithiolan-2-yl)propyl acetate is sourced from PubChem (CID 134896459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).