C12H15NS2 — CID 134896543
2-benzylsulfanyl-4,4-dimethyl-5H-1,3-thiazole (PubChem CID 134896543) has the molecular formula C12H15NS2 and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-benzylsulfanyl-4,4-dimethyl-5H-1,3-thiazole.
| Compound Name | 2-benzylsulfanyl-4,4-dimethyl-5H-1,3-thiazole |
|---|---|
| PubChem CID | 134896543 |
| Molecular Formula | C12H15NS2 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-benzylsulfanyl-4,4-dimethyl-5H-1,3-thiazole |
| SMILES | CC1(C)CSC(SCc2ccccc2)=N1 |
| InChI | InChI=1S/C12H15NS2/c1-12(2)9-15-11(13-12)14-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | XGYHCJGEHUPUKO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |