C12H14O2S2 — CID 134896592
(4R)-4-[(1R)-1-hydroxy-3-phenylpropyl]-1,3-oxathiolane-2-thione (PubChem CID 134896592) has the molecular formula C12H14O2S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (4R)-4-[(1R)-1-hydroxy-3-phenylpropyl]-1,3-oxathiolane-2-thione.
| Compound Name | (4R)-4-[(1R)-1-hydroxy-3-phenylpropyl]-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 134896592 |
| Molecular Formula | C12H14O2S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | (4R)-4-[(1R)-1-hydroxy-3-phenylpropyl]-1,3-oxathiolane-2-thione |
| SMILES | O[C@H](CCc1ccccc1)[C@H]1COC(=S)S1 |
| InChI | InChI=1S/C12H14O2S2/c13-10(11-8-14-12(15)16-11)7-6-9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | HWFDZTUMGQJZQQ-GHMZBOCLSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|