About 2,5-bis(chloromethyl)-2,5-dihydrothiophene
2,5-bis(chloromethyl)-2,5-dihydrothiophene (PubChem CID 134896615) has the molecular formula C6H8Cl2S
and a molecular weight of 183.10 g/mol. Its IUPAC name is 2,5-bis(chloromethyl)-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | 2,5-bis(chloromethyl)-2,5-dihydrothiophene |
| PubChem CID | 134896615 |
| Molecular Formula | C6H8Cl2S |
| Molecular Weight | 183.10 g/mol |
| Exact Mass | 181.97 |
| IUPAC Name | 2,5-bis(chloromethyl)-2,5-dihydrothiophene |
| SMILES | ClCC1C=CC(CCl)S1 |
| InChI | InChI=1S/C6H8Cl2S/c7-3-5-1-2-6(4-8)9-5/h1-2,5-6H,3-4H2 |
| InChIKey | JLXYLKJSBAUIQL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(chloromethyl)-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(chloromethyl)-2,5-dihydrothiophene?
The IUPAC name of 2,5-bis(chloromethyl)-2,5-dihydrothiophene (CID 134896615) is 2,5-bis(chloromethyl)-2,5-dihydrothiophene.
What is the SMILES notation for 2,5-bis(chloromethyl)-2,5-dihydrothiophene?
The canonical SMILES for 2,5-bis(chloromethyl)-2,5-dihydrothiophene is ClCC1C=CC(CCl)S1.
What is the InChIKey of 2,5-bis(chloromethyl)-2,5-dihydrothiophene?
The InChIKey is JLXYLKJSBAUIQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2S/c7-3-5-1-2-6(4-8)9-5/h1-2,5-6H,3-4H2.
What are the key properties of 2,5-bis(chloromethyl)-2,5-dihydrothiophene?
2,5-bis(chloromethyl)-2,5-dihydrothiophene has a molecular weight of 183.10 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(chloromethyl)-2,5-dihydrothiophene is sourced from PubChem (CID 134896615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).