About [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate
[3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate (PubChem CID 13489666) has the molecular formula C13H20N4O4
and a molecular weight of 296.33 g/mol. Its IUPAC name is [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate.
Molecular Properties
| Compound Name | [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate |
| PubChem CID | 13489666 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1CN(C)C(=O)N1c1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C13H20N4O4/c1-13(2,3)8-6-9(15-21-8)17-10(20-11(18)14-4)7-16(5)12(17)19/h6,10H,7H2,1-5H3,(H,14,18) |
| InChIKey | NXZULAZVZBNBOU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate?
The IUPAC name of [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate (CID 13489666) is [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate.
What is the SMILES notation for [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate?
The canonical SMILES for [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate is CNC(=O)OC1CN(C)C(=O)N1c1cc(C(C)(C)C)on1.
What is the InChIKey of [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate?
The InChIKey is NXZULAZVZBNBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O4/c1-13(2,3)8-6-9(15-21-8)17-10(20-11(18)14-4)7-16(5)12(17)19/h6,10H,7H2,1-5H3,(H,14,18).
What are the key properties of [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate?
[3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate has a molecular weight of 296.33 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-tert-butyl-1,2-oxazol-3-yl)-1-methyl-2-oxoimidazolidin-4-yl] N-methylcarbamate is sourced from PubChem (CID 13489666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).