About 1-benzyl-1-propoxyurea
1-benzyl-1-propoxyurea (PubChem CID 134896762) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-benzyl-1-propoxyurea.
Molecular Properties
| Compound Name | 1-benzyl-1-propoxyurea |
| PubChem CID | 134896762 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-benzyl-1-propoxyurea |
| SMILES | CCCON(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C11H16N2O2/c1-2-8-15-13(11(12)14)9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H2,12,14) |
| InChIKey | ZJOXKLISWJTGRU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-1-propoxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1-propoxyurea?
The IUPAC name of 1-benzyl-1-propoxyurea (CID 134896762) is 1-benzyl-1-propoxyurea.
What is the SMILES notation for 1-benzyl-1-propoxyurea?
The canonical SMILES for 1-benzyl-1-propoxyurea is CCCON(Cc1ccccc1)C(N)=O.
What is the InChIKey of 1-benzyl-1-propoxyurea?
The InChIKey is ZJOXKLISWJTGRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-2-8-15-13(11(12)14)9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H2,12,14).
What are the key properties of 1-benzyl-1-propoxyurea?
1-benzyl-1-propoxyurea has a molecular weight of 208.26 g/mol, XLogP of 1.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1-propoxyurea is sourced from PubChem (CID 134896762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).