C12H20N2O4 — CID 134896859
(2S)-1-[[(2S)-2-propan-2-yloxycarbonylaziridin-1-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 134896859) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2S)-1-[[(2S)-2-propan-2-yloxycarbonylaziridin-1-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[(2S)-2-propan-2-yloxycarbonylaziridin-1-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134896859 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (2S)-1-[[(2S)-2-propan-2-yloxycarbonylaziridin-1-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)OC(=O)[C@@H]1CN1CN1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-8(2)18-12(17)10-6-14(10)7-13-5-3-4-9(13)11(15)16/h8-10H,3-7H2,1-2H3,(H,15,16)/t9-,10-,14?/m0/s1 |
| InChIKey | ILQFCIUWBADBCF-SRQCHHPUSA-N |
| XLogP | 0.13 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|