C13H20N2O — CID 134896871
(1S,2S)-1-[(E)-ethylideneamino]oxy-N,N-dimethyl-1-phenylpropan-2-amine (PubChem CID 134896871) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (1S,2S)-1-[(E)-ethylideneamino]oxy-N,N-dimethyl-1-phenylpropan-2-amine.
| Compound Name | (1S,2S)-1-[(E)-ethylideneamino]oxy-N,N-dimethyl-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 134896871 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (1S,2S)-1-[(E)-ethylideneamino]oxy-N,N-dimethyl-1-phenylpropan-2-amine |
| SMILES | C/C=N/O[C@@H](c1ccccc1)[C@H](C)N(C)C |
| InChI | InChI=1S/C13H20N2O/c1-5-14-16-13(11(2)15(3)4)12-9-7-6-8-10-12/h5-11,13H,1-4H3/b14-5+/t11-,13+/m0/s1 |
| InChIKey | KJHDGOUQPFDRQT-CAAIZYGYSA-N |
| XLogP | 2.70 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|