C15H26O — CID 134896924
(5E,9E)-3,5,9-trimethyldodeca-1,5,9-trien-3-ol (PubChem CID 134896924) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (5E,9E)-3,5,9-trimethyldodeca-1,5,9-trien-3-ol.
| Compound Name | (5E,9E)-3,5,9-trimethyldodeca-1,5,9-trien-3-ol |
|---|---|
| PubChem CID | 134896924 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (5E,9E)-3,5,9-trimethyldodeca-1,5,9-trien-3-ol |
| SMILES | C=CC(C)(O)C/C(C)=C/CC/C(C)=C/CC |
| InChI | InChI=1S/C15H26O/c1-6-9-13(3)10-8-11-14(4)12-15(5,16)7-2/h7,9,11,16H,2,6,8,10,12H2,1,3-5H3/b13-9+,14-11+ |
| InChIKey | FLEUHLCUVPVIDN-IJFRVEDASA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|