C17H24O — CID 134897024
(1R,2R,3R,5S)-3-cyclohepta-2,4,6-trien-1-yloxy-2,6,6-trimethylbicyclo[3.1.1]heptane (PubChem CID 134897024) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (1R,2R,3R,5S)-3-cyclohepta-2,4,6-trien-1-yloxy-2,6,6-trimethylbicyclo[3.1.1]heptane.
| Compound Name | (1R,2R,3R,5S)-3-cyclohepta-2,4,6-trien-1-yloxy-2,6,6-trimethylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 134897024 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1R,2R,3R,5S)-3-cyclohepta-2,4,6-trien-1-yloxy-2,6,6-trimethylbicyclo[3.1.1]heptane |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1OC1C=CC=CC=C1)C2(C)C |
| InChI | InChI=1S/C17H24O/c1-12-15-10-13(17(15,2)3)11-16(12)18-14-8-6-4-5-7-9-14/h4-9,12-16H,10-11H2,1-3H3/t12-,13+,15-,16-/m1/s1 |
| InChIKey | LPSKBBHNOUOLRC-OCVGTWLNSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |