C15H20 — CID 134897045
8,9-dimethyl-10,11-dimethylidenetricyclo[5.2.2.01,7]undec-8-ene (PubChem CID 134897045) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 8,9-dimethyl-10,11-dimethylidenetricyclo[5.2.2.01,7]undec-8-ene.
| Compound Name | 8,9-dimethyl-10,11-dimethylidenetricyclo[5.2.2.01,7]undec-8-ene |
|---|---|
| PubChem CID | 134897045 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 8,9-dimethyl-10,11-dimethylidenetricyclo[5.2.2.01,7]undec-8-ene |
| SMILES | C=C1C(=C)C23CCCCCC12C(C)=C3C |
| InChI | InChI=1S/C15H20/c1-10-11(2)15-9-7-5-6-8-14(10,15)12(3)13(15)4/h1-2,5-9H2,3-4H3 |
| InChIKey | FSPZUKSTGPGPFJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|