About N-(2-fluoro-2,2-dinitroethyl)butan-1-amine
N-(2-fluoro-2,2-dinitroethyl)butan-1-amine (PubChem CID 134897088) has the molecular formula C6H12FN3O4
and a molecular weight of 209.18 g/mol. Its IUPAC name is N-(2-fluoro-2,2-dinitroethyl)butan-1-amine.
Molecular Properties
| Compound Name | N-(2-fluoro-2,2-dinitroethyl)butan-1-amine |
| PubChem CID | 134897088 |
| Molecular Formula | C6H12FN3O4 |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | N-(2-fluoro-2,2-dinitroethyl)butan-1-amine |
| SMILES | CCCCNCC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H12FN3O4/c1-2-3-4-8-5-6(7,9(11)12)10(13)14/h8H,2-5H2,1H3 |
| InChIKey | MMPBYRSQGPZIRB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluoro-2,2-dinitroethyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoro-2,2-dinitroethyl)butan-1-amine?
The IUPAC name of N-(2-fluoro-2,2-dinitroethyl)butan-1-amine (CID 134897088) is N-(2-fluoro-2,2-dinitroethyl)butan-1-amine.
What is the SMILES notation for N-(2-fluoro-2,2-dinitroethyl)butan-1-amine?
The canonical SMILES for N-(2-fluoro-2,2-dinitroethyl)butan-1-amine is CCCCNCC(F)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of N-(2-fluoro-2,2-dinitroethyl)butan-1-amine?
The InChIKey is MMPBYRSQGPZIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FN3O4/c1-2-3-4-8-5-6(7,9(11)12)10(13)14/h8H,2-5H2,1H3.
What are the key properties of N-(2-fluoro-2,2-dinitroethyl)butan-1-amine?
N-(2-fluoro-2,2-dinitroethyl)butan-1-amine has a molecular weight of 209.18 g/mol, XLogP of 0.55, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoro-2,2-dinitroethyl)butan-1-amine is sourced from PubChem (CID 134897088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).