C13H22O2 — CID 134897173
(2Z)-2-(2,2-dimethylpropylidene)-6,6-dimethyl-4,8-dioxaspiro[2.5]octane (PubChem CID 134897173) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (2Z)-2-(2,2-dimethylpropylidene)-6,6-dimethyl-4,8-dioxaspiro[2.5]octane.
| Compound Name | (2Z)-2-(2,2-dimethylpropylidene)-6,6-dimethyl-4,8-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 134897173 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (2Z)-2-(2,2-dimethylpropylidene)-6,6-dimethyl-4,8-dioxaspiro[2.5]octane |
| SMILES | CC(C)(C)/C=C1/CC12OCC(C)(C)CO2 |
| InChI | InChI=1S/C13H22O2/c1-11(2,3)6-10-7-13(10)14-8-12(4,5)9-15-13/h6H,7-9H2,1-5H3/b10-6- |
| InChIKey | RYSLDJRJFFULEY-POHAHGRESA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|