About 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol
3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol (PubChem CID 134897381) has the molecular formula C5H10FN3O6
and a molecular weight of 227.15 g/mol. Its IUPAC name is 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol |
| PubChem CID | 134897381 |
| Molecular Formula | C5H10FN3O6 |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol |
| SMILES | O=[N+]([O-])C(F)(CNCC(O)CO)[N+](=O)[O-] |
| InChI | InChI=1S/C5H10FN3O6/c6-5(8(12)13,9(14)15)3-7-1-4(11)2-10/h4,7,10-11H,1-3H2 |
| InChIKey | PRMKRJWKZKXULD-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol?
The IUPAC name of 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol (CID 134897381) is 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol.
What is the SMILES notation for 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol?
The canonical SMILES for 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol is O=[N+]([O-])C(F)(CNCC(O)CO)[N+](=O)[O-].
What is the InChIKey of 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol?
The InChIKey is PRMKRJWKZKXULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FN3O6/c6-5(8(12)13,9(14)15)3-7-1-4(11)2-10/h4,7,10-11H,1-3H2.
What are the key properties of 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol?
3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol has a molecular weight of 227.15 g/mol, XLogP of -1.89, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-fluoro-2,2-dinitroethyl)amino]propane-1,2-diol is sourced from PubChem (CID 134897381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).