About butyl(methyl)azanium nitrate
butyl(methyl)azanium nitrate (PubChem CID 134897425) has the molecular formula C5H14N2O3
and a molecular weight of 150.18 g/mol. Its IUPAC name is butyl(methyl)azanium nitrate.
Molecular Properties
| Compound Name | butyl(methyl)azanium nitrate |
| PubChem CID | 134897425 |
| Molecular Formula | C5H14N2O3 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | butyl(methyl)azanium nitrate |
| SMILES | CCCC[NH2+]C.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C5H13N.NO3/c1-3-4-5-6-2;2-1(3)4/h6H,3-5H2,1-2H3;/q;-1/p+1 |
| InChIKey | CZKIXXLHDAIARU-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl(methyl)azanium nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(methyl)azanium nitrate?
The IUPAC name of butyl(methyl)azanium nitrate (CID 134897425) is butyl(methyl)azanium nitrate.
What is the SMILES notation for butyl(methyl)azanium nitrate?
The canonical SMILES for butyl(methyl)azanium nitrate is CCCC[NH2+]C.O=[N+]([O-])[O-].
What is the InChIKey of butyl(methyl)azanium nitrate?
The InChIKey is CZKIXXLHDAIARU-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H13N.NO3/c1-3-4-5-6-2;2-1(3)4/h6H,3-5H2,1-2H3;/q;-1/p+1.
What are the key properties of butyl(methyl)azanium nitrate?
butyl(methyl)azanium nitrate has a molecular weight of 150.18 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(methyl)azanium nitrate is sourced from PubChem (CID 134897425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).