About [(Z)-pent-1-enyl] trifluoromethanesulfonate
[(Z)-pent-1-enyl] trifluoromethanesulfonate (PubChem CID 134897535) has the molecular formula C6H9F3O3S
and a molecular weight of 218.20 g/mol. Its IUPAC name is [(Z)-pent-1-enyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(Z)-pent-1-enyl] trifluoromethanesulfonate |
| PubChem CID | 134897535 |
| Molecular Formula | C6H9F3O3S |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | [(Z)-pent-1-enyl] trifluoromethanesulfonate |
| SMILES | CCC/C=C\OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H9F3O3S/c1-2-3-4-5-12-13(10,11)6(7,8)9/h4-5H,2-3H2,1H3/b5-4- |
| InChIKey | KPLPIXHNCINTBV-PLNGDYQASA-N |
| XLogP | 2.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-pent-1-enyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-pent-1-enyl] trifluoromethanesulfonate?
The IUPAC name of [(Z)-pent-1-enyl] trifluoromethanesulfonate (CID 134897535) is [(Z)-pent-1-enyl] trifluoromethanesulfonate.
What is the SMILES notation for [(Z)-pent-1-enyl] trifluoromethanesulfonate?
The canonical SMILES for [(Z)-pent-1-enyl] trifluoromethanesulfonate is CCC/C=C\OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [(Z)-pent-1-enyl] trifluoromethanesulfonate?
The InChIKey is KPLPIXHNCINTBV-PLNGDYQASA-N. The full InChI is InChI=1S/C6H9F3O3S/c1-2-3-4-5-12-13(10,11)6(7,8)9/h4-5H,2-3H2,1H3/b5-4-.
What are the key properties of [(Z)-pent-1-enyl] trifluoromethanesulfonate?
[(Z)-pent-1-enyl] trifluoromethanesulfonate has a molecular weight of 218.20 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-pent-1-enyl] trifluoromethanesulfonate is sourced from PubChem (CID 134897535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).