About 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane
2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane (PubChem CID 134897609) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane.
Molecular Properties
| Compound Name | 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane |
| PubChem CID | 134897609 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane |
| SMILES | CC(C)=C/C=C\C(C)CC1CC(C)CCO1 |
| InChI | InChI=1S/C15H26O/c1-12(2)6-5-7-13(3)10-15-11-14(4)8-9-16-15/h5-7,13-15H,8-11H2,1-4H3/b7-5- |
| InChIKey | UJFMWWBHHMIZIZ-ALCCZGGFSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane?
The IUPAC name of 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane (CID 134897609) is 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane.
What is the SMILES notation for 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane?
The canonical SMILES for 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane is CC(C)=C/C=C\C(C)CC1CC(C)CCO1.
What is the InChIKey of 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane?
The InChIKey is UJFMWWBHHMIZIZ-ALCCZGGFSA-N. The full InChI is InChI=1S/C15H26O/c1-12(2)6-5-7-13(3)10-15-11-14(4)8-9-16-15/h5-7,13-15H,8-11H2,1-4H3/b7-5-.
What are the key properties of 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane?
2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane has a molecular weight of 222.37 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3Z)-2,6-dimethylhepta-3,5-dienyl]-4-methyloxane is sourced from PubChem (CID 134897609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).