C9H18BrNOZn — CID 134897619
bromozinc(1+);N,N-diethylpentanamide (PubChem CID 134897619) has the molecular formula C9H18BrNOZn and a molecular weight of 301.54 g/mol. Its IUPAC name is bromozinc(1+);N,N-diethylpentanamide.
| Compound Name | bromozinc(1+);N,N-diethylpentanamide |
|---|---|
| PubChem CID | 134897619 |
| Molecular Formula | C9H18BrNOZn |
| Molecular Weight | 301.54 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | bromozinc(1+);N,N-diethylpentanamide |
| SMILES | [CH2-]CCCC(=O)N(CC)CC.[Zn+]Br |
| InChI | InChI=1S/C9H18NO.BrH.Zn/c1-4-7-8-9(11)10(5-2)6-3;;/h1,4-8H2,2-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | RGQWAFFJPZKTQT-UHFFFAOYSA-M |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|