C11H10O2S — CID 134897714
(3aS,4R,9S,9aR)-4,9-dideuterio-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzodioxole-2-thione (PubChem CID 134897714) has the molecular formula C11H10O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is (3aS,4R,9S,9aR)-4,9-dideuterio-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzodioxole-2-thione.
| Compound Name | (3aS,4R,9S,9aR)-4,9-dideuterio-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzodioxole-2-thione |
|---|---|
| PubChem CID | 134897714 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (3aS,4R,9S,9aR)-4,9-dideuterio-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzodioxole-2-thione |
| SMILES | [2H][C@@H]1c2ccccc2[C@H]([2H])[C@H]2OC(=S)O[C@H]21 |
| InChI | InChI=1S/C11H10O2S/c14-11-12-9-5-7-3-1-2-4-8(7)6-10(9)13-11/h1-4,9-10H,5-6H2/t9-,10+/i5D,6D/t5-,6+,9+,10- |
| InChIKey | DAIAXWMVOMTBJG-JMKJOLRFSA-N |
| XLogP | 1.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|