About (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol
(6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol (PubChem CID 134897745) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol.
Molecular Properties
| Compound Name | (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol |
| PubChem CID | 134897745 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol |
| SMILES | CC(C)=CCC/C(C)=C\CCC#CCO |
| InChI | InChI=1S/C14H22O/c1-13(2)9-8-11-14(3)10-6-4-5-7-12-15/h9-10,15H,4,6,8,11-12H2,1-3H3/b14-10- |
| InChIKey | SVNPXCFLXBYXIJ-UVTDQMKNSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol?
The IUPAC name of (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol (CID 134897745) is (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol.
What is the SMILES notation for (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol?
The canonical SMILES for (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol is CC(C)=CCC/C(C)=C\CCC#CCO.
What is the InChIKey of (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol?
The InChIKey is SVNPXCFLXBYXIJ-UVTDQMKNSA-N. The full InChI is InChI=1S/C14H22O/c1-13(2)9-8-11-14(3)10-6-4-5-7-12-15/h9-10,15H,4,6,8,11-12H2,1-3H3/b14-10-.
What are the key properties of (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol?
(6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol has a molecular weight of 206.33 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-7,11-dimethyldodeca-6,10-dien-2-yn-1-ol is sourced from PubChem (CID 134897745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).