About 2,5-dicyclopropylcyclohepta-1,3,5-triene
2,5-dicyclopropylcyclohepta-1,3,5-triene (PubChem CID 134897785) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,5-dicyclopropylcyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 2,5-dicyclopropylcyclohepta-1,3,5-triene |
| PubChem CID | 134897785 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2,5-dicyclopropylcyclohepta-1,3,5-triene |
| SMILES | C1=CC(C2CC2)=CCC=C1C1CC1 |
| InChI | InChI=1S/C13H16/c1-2-10(12-6-7-12)4-5-11(3-1)13-8-9-13/h2-5,12-13H,1,6-9H2 |
| InChIKey | LTIPSJMCOIEPPQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,5-dicyclopropylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dicyclopropylcyclohepta-1,3,5-triene?
The IUPAC name of 2,5-dicyclopropylcyclohepta-1,3,5-triene (CID 134897785) is 2,5-dicyclopropylcyclohepta-1,3,5-triene.
What is the SMILES notation for 2,5-dicyclopropylcyclohepta-1,3,5-triene?
The canonical SMILES for 2,5-dicyclopropylcyclohepta-1,3,5-triene is C1=CC(C2CC2)=CCC=C1C1CC1.
What is the InChIKey of 2,5-dicyclopropylcyclohepta-1,3,5-triene?
The InChIKey is LTIPSJMCOIEPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16/c1-2-10(12-6-7-12)4-5-11(3-1)13-8-9-13/h2-5,12-13H,1,6-9H2.
What are the key properties of 2,5-dicyclopropylcyclohepta-1,3,5-triene?
2,5-dicyclopropylcyclohepta-1,3,5-triene has a molecular weight of 172.27 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dicyclopropylcyclohepta-1,3,5-triene is sourced from PubChem (CID 134897785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).