About 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene
2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene (PubChem CID 134897818) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene |
| PubChem CID | 134897818 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene |
| SMILES | CC(C)(C)C1=CC(C2C=CC(C(C)(C)C)=C2)C=C1 |
| InChI | InChI=1S/C18H26/c1-17(2,3)15-9-7-13(11-15)14-8-10-16(12-14)18(4,5)6/h7-14H,1-6H3 |
| InChIKey | ONTMWHZNNKEOJU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene?
The IUPAC name of 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene (CID 134897818) is 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene.
What is the SMILES notation for 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene?
The canonical SMILES for 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene is CC(C)(C)C1=CC(C2C=CC(C(C)(C)C)=C2)C=C1.
What is the InChIKey of 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene?
The InChIKey is ONTMWHZNNKEOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26/c1-17(2,3)15-9-7-13(11-15)14-8-10-16(12-14)18(4,5)6/h7-14H,1-6H3.
What are the key properties of 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene?
2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene has a molecular weight of 242.41 g/mol, XLogP of 5.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(3-tert-butylcyclopenta-2,4-dien-1-yl)cyclopenta-1,3-diene is sourced from PubChem (CID 134897818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).