About trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide
trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide (PubChem CID 134897877) has the molecular formula C12H28N2O2
and a molecular weight of 232.37 g/mol. Its IUPAC name is trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide.
Molecular Properties
| Compound Name | trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide |
| PubChem CID | 134897877 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide |
| SMILES | C[N+](C)(C)CC1C=CC1C[N+](C)(C)C.[OH-].[OH-] |
| InChI | InChI=1S/C12H26N2.2H2O/c1-13(2,3)9-11-7-8-12(11)10-14(4,5)6;;/h7-8,11-12H,9-10H2,1-6H3;2*1H2/q+2;;/p-2 |
| InChIKey | SUTMJROUKADYGI-UHFFFAOYSA-L |
| XLogP | 0.85 |
| TPSA | 60.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide?
The IUPAC name of trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide (CID 134897877) is trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide.
What is the SMILES notation for trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide?
The canonical SMILES for trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide is C[N+](C)(C)CC1C=CC1C[N+](C)(C)C.[OH-].[OH-].
What is the InChIKey of trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide?
The InChIKey is SUTMJROUKADYGI-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H26N2.2H2O/c1-13(2,3)9-11-7-8-12(11)10-14(4,5)6;;/h7-8,11-12H,9-10H2,1-6H3;2*1H2/q+2;;/p-2.
What are the key properties of trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide?
trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide has a molecular weight of 232.37 g/mol, XLogP of 0.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[[4-[(trimethylazaniumyl)methyl]cyclobut-2-en-1-yl]methyl]azanium dihydroxide is sourced from PubChem (CID 134897877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).