About 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one
4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one (PubChem CID 134897886) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one |
| PubChem CID | 134897886 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one |
| SMILES | CN1C=CC(N(C)C)N(C)C1=O |
| InChI | InChI=1S/C8H15N3O/c1-9(2)7-5-6-10(3)8(12)11(7)4/h5-7H,1-4H3 |
| InChIKey | IMPOWUHKUBXOMN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one?
The IUPAC name of 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one (CID 134897886) is 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one.
What is the SMILES notation for 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one?
The canonical SMILES for 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one is CN1C=CC(N(C)C)N(C)C1=O.
What is the InChIKey of 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one?
The InChIKey is IMPOWUHKUBXOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-9(2)7-5-6-10(3)8(12)11(7)4/h5-7H,1-4H3.
What are the key properties of 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one?
4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one has a molecular weight of 169.23 g/mol, XLogP of 0.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-1,3-dimethyl-4H-pyrimidin-2-one is sourced from PubChem (CID 134897886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).