C11H14O — CID 134897939
(3E)-3,4-dimethylnona-3,7,8-trien-5-yn-2-ol (PubChem CID 134897939) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (3E)-3,4-dimethylnona-3,7,8-trien-5-yn-2-ol.
| Compound Name | (3E)-3,4-dimethylnona-3,7,8-trien-5-yn-2-ol |
|---|---|
| PubChem CID | 134897939 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3E)-3,4-dimethylnona-3,7,8-trien-5-yn-2-ol |
| SMILES | C=C=CC#C/C(C)=C(\C)C(C)O |
| InChI | InChI=1S/C11H14O/c1-5-6-7-8-9(2)10(3)11(4)12/h6,11-12H,1H2,2-4H3/b10-9+ |
| InChIKey | QHERNLFWELMAHQ-MDZDMXLPSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|