C12H16O3 — CID 134897964
(2R,5E,6R)-2-tert-butyl-6-methyl-5-prop-2-ynylidene-1,3-dioxan-4-one (PubChem CID 134897964) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2R,5E,6R)-2-tert-butyl-6-methyl-5-prop-2-ynylidene-1,3-dioxan-4-one.
| Compound Name | (2R,5E,6R)-2-tert-butyl-6-methyl-5-prop-2-ynylidene-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 134897964 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2R,5E,6R)-2-tert-butyl-6-methyl-5-prop-2-ynylidene-1,3-dioxan-4-one |
| SMILES | C#C/C=C1/C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C12H16O3/c1-6-7-9-8(2)14-11(12(3,4)5)15-10(9)13/h1,7-8,11H,2-5H3/b9-7+/t8-,11-/m1/s1 |
| InChIKey | IIRGRZNMPAJBEY-FSZMIWMDSA-N |
| XLogP | 1.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|