About bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene
bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene (PubChem CID 134898169) has the molecular formula C5H6BrF3OZn
and a molecular weight of 284.39 g/mol. Its IUPAC name is bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene.
Molecular Properties
| Compound Name | bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene |
| PubChem CID | 134898169 |
| Molecular Formula | C5H6BrF3OZn |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene |
| SMILES | CCO/C=[C-]/C(F)(F)F.[Zn+]Br |
| InChI | InChI=1S/C5H6F3O.BrH.Zn/c1-2-9-4-3-5(6,7)8;;/h4H,2H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | SFJFIMFPOGYKHJ-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene?
The IUPAC name of bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene (CID 134898169) is bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene.
What is the SMILES notation for bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene?
The canonical SMILES for bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene is CCO/C=[C-]/C(F)(F)F.[Zn+]Br.
What is the InChIKey of bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene?
The InChIKey is SFJFIMFPOGYKHJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6F3O.BrH.Zn/c1-2-9-4-3-5(6,7)8;;/h4H,2H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene?
bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene has a molecular weight of 284.39 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);1-ethoxy-3,3,3-trifluoroprop-1-ene is sourced from PubChem (CID 134898169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).