C20H17CrNO4 — CID 134898910
carbon monoxide;chromium;4,4-dimethyl-2-(2-phenylphenyl)-5H-1,3-oxazole (PubChem CID 134898910) has the molecular formula C20H17CrNO4 and a molecular weight of 387.36 g/mol. Its IUPAC name is carbon monoxide;chromium;4,4-dimethyl-2-(2-phenylphenyl)-5H-1,3-oxazole.
| Compound Name | carbon monoxide;chromium;4,4-dimethyl-2-(2-phenylphenyl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 134898910 |
| Molecular Formula | C20H17CrNO4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | carbon monoxide;chromium;4,4-dimethyl-2-(2-phenylphenyl)-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccccc2-c2ccccc2)=N1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C17H17NO.3CO.Cr/c1-17(2)12-19-16(18-17)15-11-7-6-10-14(15)13-8-4-3-5-9-13;3*1-2;/h3-11H,12H2,1-2H3;;;; |
| InChIKey | NISVKNHHKMZZFK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|