C19H17CrNO4 — CID 134899212
carbon monoxide;chromium;(3S,5R)-2-methyl-3,5-diphenyl-1,2-oxazolidine (PubChem CID 134899212) has the molecular formula C19H17CrNO4 and a molecular weight of 375.34 g/mol. Its IUPAC name is carbon monoxide;chromium;(3S,5R)-2-methyl-3,5-diphenyl-1,2-oxazolidine.
| Compound Name | carbon monoxide;chromium;(3S,5R)-2-methyl-3,5-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134899212 |
| Molecular Formula | C19H17CrNO4 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | carbon monoxide;chromium;(3S,5R)-2-methyl-3,5-diphenyl-1,2-oxazolidine |
| SMILES | CN1O[C@@H](c2ccccc2)C[C@H]1c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C16H17NO.3CO.Cr/c1-17-15(13-8-4-2-5-9-13)12-16(18-17)14-10-6-3-7-11-14;3*1-2;/h2-11,15-16H,12H2,1H3;;;;/t15-,16+;;;;/m0..../s1 |
| InChIKey | ROWFHLPDHXRAKK-PBDYATHVSA-N |
| XLogP | 3.62 |
| TPSA | 72.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|