About CID 134899397
CID 134899397 (PubChem CID 134899397) has the molecular formula C25H33CoO2
and a molecular weight of 424.47 g/mol.
Molecular Properties
| Compound Name | CID 134899397 |
| PubChem CID | 134899397 |
| Molecular Formula | C25H33CoO2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | — |
| SMILES | CC1=C2C(=C3CCCCC3=CC2(C)C)CC2(C1)OCCCO2.[CH]1C=CC=C1.[Co] |
| InChI | InChI=1S/C20H28O2.C5H5.Co/c1-14-11-20(21-9-6-10-22-20)13-17-16-8-5-4-7-15(16)12-19(2,3)18(14)17;1-2-4-5-3-1;/h12H,4-11,13H2,1-3H3;1-5H; |
| InChIKey | DTAJFXNFVUQGCI-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 134899397 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134899397?
The IUPAC name of CID 134899397 (CID 134899397) is not available.
What is the SMILES notation for CID 134899397?
The canonical SMILES for CID 134899397 is CC1=C2C(=C3CCCCC3=CC2(C)C)CC2(C1)OCCCO2.[CH]1C=CC=C1.[Co].
What is the InChIKey of CID 134899397?
The InChIKey is DTAJFXNFVUQGCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O2.C5H5.Co/c1-14-11-20(21-9-6-10-22-20)13-17-16-8-5-4-7-15(16)12-19(2,3)18(14)17;1-2-4-5-3-1;/h12H,4-11,13H2,1-3H3;1-5H;.
What are the key properties of CID 134899397?
CID 134899397 has a molecular weight of 424.47 g/mol, XLogP of 6.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134899397 is sourced from PubChem (CID 134899397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).