C14H26OSi2 — CID 134899405
trimethyl-(2-trimethylsilyl-5,6,7,7a-tetrahydrocyclopenta[b]pyran-3-yl)silane (PubChem CID 134899405) has the molecular formula C14H26OSi2 and a molecular weight of 266.53 g/mol. Its IUPAC name is trimethyl-(2-trimethylsilyl-5,6,7,7a-tetrahydrocyclopenta[b]pyran-3-yl)silane.
| Compound Name | trimethyl-(2-trimethylsilyl-5,6,7,7a-tetrahydrocyclopenta[b]pyran-3-yl)silane |
|---|---|
| PubChem CID | 134899405 |
| Molecular Formula | C14H26OSi2 |
| Molecular Weight | 266.53 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | trimethyl-(2-trimethylsilyl-5,6,7,7a-tetrahydrocyclopenta[b]pyran-3-yl)silane |
| SMILES | C[Si](C)(C)C1=C([Si](C)(C)C)OC2CCCC2=C1 |
| InChI | InChI=1S/C14H26OSi2/c1-16(2,3)13-10-11-8-7-9-12(11)15-14(13)17(4,5)6/h10,12H,7-9H2,1-6H3 |
| InChIKey | YEHSXNNQBJEWLJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|