About methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate
methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate (PubChem CID 134899515) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate |
| PubChem CID | 134899515 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate |
| SMILES | COC(=O)CC1CCN(C(C)C)C(=O)N1C(C)C |
| InChI | InChI=1S/C13H24N2O3/c1-9(2)14-7-6-11(8-12(16)18-5)15(10(3)4)13(14)17/h9-11H,6-8H2,1-5H3 |
| InChIKey | NPEVKHPHZPBEHW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate?
The IUPAC name of methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate (CID 134899515) is methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate.
What is the SMILES notation for methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate?
The canonical SMILES for methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate is COC(=O)CC1CCN(C(C)C)C(=O)N1C(C)C.
What is the InChIKey of methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate?
The InChIKey is NPEVKHPHZPBEHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-9(2)14-7-6-11(8-12(16)18-5)15(10(3)4)13(14)17/h9-11H,6-8H2,1-5H3.
What are the key properties of methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate?
methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate has a molecular weight of 256.35 g/mol, XLogP of 1.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-oxo-1,3-di(propan-2-yl)-1,3-diazinan-4-yl]acetate is sourced from PubChem (CID 134899515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).