About CID 134899646
CID 134899646 (PubChem CID 134899646) has the molecular formula C17H25IrO
and a molecular weight of 437.60 g/mol.
Molecular Properties
| Compound Name | CID 134899646 |
| PubChem CID | 134899646 |
| Molecular Formula | C17H25IrO |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | — |
| SMILES | COC1=CC=CCC1.C[C]1C(C)=C(C)C(C)=C1C.[Ir] |
| InChI | InChI=1S/C10H15.C7H10O.Ir/c1-6-7(2)9(4)10(5)8(6)3;1-8-7-5-3-2-4-6-7;/h1-5H3;2-3,5H,4,6H2,1H3; |
| InChIKey | LHKAGPLEDKWSAB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 134899646 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134899646?
The IUPAC name of CID 134899646 (CID 134899646) is not available.
What is the SMILES notation for CID 134899646?
The canonical SMILES for CID 134899646 is COC1=CC=CCC1.C[C]1C(C)=C(C)C(C)=C1C.[Ir].
What is the InChIKey of CID 134899646?
The InChIKey is LHKAGPLEDKWSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15.C7H10O.Ir/c1-6-7(2)9(4)10(5)8(6)3;1-8-7-5-3-2-4-6-7;/h1-5H3;2-3,5H,4,6H2,1H3;.
What are the key properties of CID 134899646?
CID 134899646 has a molecular weight of 437.60 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134899646 is sourced from PubChem (CID 134899646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).