C21H32O2 — CID 134900421
3,3-bis[(2E)-octa-2,7-dienyl]pentane-2,4-dione (PubChem CID 134900421) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 3,3-bis[(2E)-octa-2,7-dienyl]pentane-2,4-dione.
| Compound Name | 3,3-bis[(2E)-octa-2,7-dienyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 134900421 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 3,3-bis[(2E)-octa-2,7-dienyl]pentane-2,4-dione |
| SMILES | C=CCCC/C=C/CC(C/C=C/CCCC=C)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C21H32O2/c1-5-7-9-11-13-15-17-21(19(3)22,20(4)23)18-16-14-12-10-8-6-2/h5-6,13-16H,1-2,7-12,17-18H2,3-4H3/b15-13+,16-14+ |
| InChIKey | NCVCHNOFAIYBAN-WXUKJITCSA-N |
| XLogP | 5.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|