methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate

C13H22O2Si — CID 134900457

IUPACmethyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate
SMILESCOC(=O)C/C(C#C[Si](C)(C)C)=C/C(C)C
InChIInChI=1S/C13H22O2Si/c1-11(2)9-12(10-13(14)15-3)7-8-16(4,5)6/h9,11H,10H2,1-6H3/b12-9+
InChIKeyXKONHMBJCSKADZ-FMIVXFBMSA-N
MW238.40 g/mol
LogP3.01
Rot. Bonds3

About methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate

methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate (PubChem CID 134900457) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate.

Molecular Properties

Compound Namemethyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate
PubChem CID134900457
Molecular FormulaC13H22O2Si
Molecular Weight238.40 g/mol
Exact Mass238.14
IUPAC Namemethyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate
SMILESCOC(=O)C/C(C#C[Si](C)(C)C)=C/C(C)C
InChIInChI=1S/C13H22O2Si/c1-11(2)9-12(10-13(14)15-3)7-8-16(4,5)6/h9,11H,10H2,1-6H3/b12-9+
InChIKeyXKONHMBJCSKADZ-FMIVXFBMSA-N
XLogP3.01
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.40
LogP ≤ 53.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate?
The IUPAC name of methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate (CID 134900457) is methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate.
What is the SMILES notation for methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate?
The canonical SMILES for methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate is COC(=O)C/C(C#C[Si](C)(C)C)=C/C(C)C.
What is the InChIKey of methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate?
The InChIKey is XKONHMBJCSKADZ-FMIVXFBMSA-N. The full InChI is InChI=1S/C13H22O2Si/c1-11(2)9-12(10-13(14)15-3)7-8-16(4,5)6/h9,11H,10H2,1-6H3/b12-9+.
What are the key properties of methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate?
methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate has a molecular weight of 238.40 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-5-methyl-3-(2-trimethylsilylethynyl)hex-3-enoate is sourced from PubChem (CID 134900457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).