C18H23NO4S — CID 134900504
(4S,5S)-5-methyl-4-[(4E)-3-methylhexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one (PubChem CID 134900504) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is (4S,5S)-5-methyl-4-[(4E)-3-methylhexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-methyl-4-[(4E)-3-methylhexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134900504 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (4S,5S)-5-methyl-4-[(4E)-3-methylhexa-1,4-dien-2-yl]-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| SMILES | C=C(C(C)/C=C/C)[C@H]1[C@H](C)OC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO4S/c1-6-7-13(3)14(4)17-15(5)23-18(20)19(17)24(21,22)16-10-8-12(2)9-11-16/h6-11,13,15,17H,4H2,1-3,5H3/b7-6+/t13?,15-,17-/m0/s1 |
| InChIKey | FUGVEGBAHCSNPM-HQDJIPNWSA-N |
| XLogP | 3.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|