C16H28O2 — CID 134900860
(1S,2R,4R)-2-[(1Z,3E)-4-methoxy-2-methylbuta-1,3-dienoxy]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 134900860) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(1Z,3E)-4-methoxy-2-methylbuta-1,3-dienoxy]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(1Z,3E)-4-methoxy-2-methylbuta-1,3-dienoxy]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 134900860 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1S,2R,4R)-2-[(1Z,3E)-4-methoxy-2-methylbuta-1,3-dienoxy]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CO/C=C/C(C)=C\O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C16H28O2/c1-12(2)15-7-6-13(3)10-16(15)18-11-14(4)8-9-17-5/h8-9,11-13,15-16H,6-7,10H2,1-5H3/b9-8+,14-11-/t13-,15+,16-/m1/s1 |
| InChIKey | VDEUZRWKGUAMNY-IDEQEDLLSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|