About [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile
[dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile (PubChem CID 134900930) has the molecular formula C21H35NOSi
and a molecular weight of 345.60 g/mol. Its IUPAC name is [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile.
Molecular Properties
| Compound Name | [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile |
| PubChem CID | 134900930 |
| Molecular Formula | C21H35NOSi |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O[Si](C)(C)C#N)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H35NOSi/c1-19(2,3)15-12-16(20(4,5)6)18(23-24(10,11)14-22)17(13-15)21(7,8)9/h12-13H,1-11H3 |
| InChIKey | SBENFNFANGKVCY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile?
The IUPAC name of [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile (CID 134900930) is [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile.
What is the SMILES notation for [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile?
The canonical SMILES for [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile is CC(C)(C)c1cc(C(C)(C)C)c(O[Si](C)(C)C#N)c(C(C)(C)C)c1.
What is the InChIKey of [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile?
The InChIKey is SBENFNFANGKVCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NOSi/c1-19(2,3)15-12-16(20(4,5)6)18(23-24(10,11)14-22)17(13-15)21(7,8)9/h12-13H,1-11H3.
What are the key properties of [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile?
[dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile has a molecular weight of 345.60 g/mol, XLogP of 6.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl-(2,4,6-tritert-butylphenoxy)silyl]formonitrile is sourced from PubChem (CID 134900930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).