C11H16O3Si — CID 134901001
(3aS,4S,7aR)-4-trimethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 134901001) has the molecular formula C11H16O3Si and a molecular weight of 224.33 g/mol. Its IUPAC name is (3aS,4S,7aR)-4-trimethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aS,4S,7aR)-4-trimethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 134901001 |
| Molecular Formula | C11H16O3Si |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (3aS,4S,7aR)-4-trimethylsilyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | C[Si](C)(C)[C@H]1C=CC[C@H]2C(=O)OC(=O)[C@H]21 |
| InChI | InChI=1S/C11H16O3Si/c1-15(2,3)8-6-4-5-7-9(8)11(13)14-10(7)12/h4,6-9H,5H2,1-3H3/t7-,8+,9-/m1/s1 |
| InChIKey | LAGWFXSALJMFGU-HRDYMLBCSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|