C12H20O2 — CID 134901003
(8R,8aS)-8-methoxy-5-methylidene-1,2,3,4,6,7,8,8a-octahydroazulen-3a-ol (PubChem CID 134901003) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (8R,8aS)-8-methoxy-5-methylidene-1,2,3,4,6,7,8,8a-octahydroazulen-3a-ol.
| Compound Name | (8R,8aS)-8-methoxy-5-methylidene-1,2,3,4,6,7,8,8a-octahydroazulen-3a-ol |
|---|---|
| PubChem CID | 134901003 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (8R,8aS)-8-methoxy-5-methylidene-1,2,3,4,6,7,8,8a-octahydroazulen-3a-ol |
| SMILES | C=C1CC[C@@H](OC)[C@@H]2CCCC2(O)C1 |
| InChI | InChI=1S/C12H20O2/c1-9-5-6-11(14-2)10-4-3-7-12(10,13)8-9/h10-11,13H,1,3-8H2,2H3/t10-,11+,12?/m0/s1 |
| InChIKey | SKBISLRQHXVPCH-WIKAKEFZSA-N |
| XLogP | 2.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|