C11H16O3 — CID 134901173
(3aS,4S,7R,7aS)-4-[(1S)-1-hydroxyethyl]-7-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 134901173) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (3aS,4S,7R,7aS)-4-[(1S)-1-hydroxyethyl]-7-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3aS,4S,7R,7aS)-4-[(1S)-1-hydroxyethyl]-7-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134901173 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (3aS,4S,7R,7aS)-4-[(1S)-1-hydroxyethyl]-7-methyl-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@H](O)[C@H]1C=C[C@@H](C)[C@@H]2C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C11H16O3/c1-6-3-4-8(7(2)12)9-5-14-11(13)10(6)9/h3-4,6-10,12H,5H2,1-2H3/t6-,7+,8-,9+,10+/m1/s1 |
| InChIKey | QBUZXDBDNVMGOD-KGDYZURWSA-N |
| XLogP | 0.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|