About CID 134901174
CID 134901174 (PubChem CID 134901174) has the molecular formula C16H31O2Si
and a molecular weight of 283.51 g/mol.
Molecular Properties
| Compound Name | CID 134901174 |
| PubChem CID | 134901174 |
| Molecular Formula | C16H31O2Si |
| Molecular Weight | 283.51 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | — |
| SMILES | C=CC(CCCCCCOC1CCCCO1)[Si](C)C |
| InChI | InChI=1S/C16H31O2Si/c1-4-15(19(2)3)11-7-5-6-9-13-17-16-12-8-10-14-18-16/h4,15-16H,1,5-14H2,2-3H3 |
| InChIKey | UYJZUEBRZFXNAL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 134901174 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134901174?
The IUPAC name of CID 134901174 (CID 134901174) is not available.
What is the SMILES notation for CID 134901174?
The canonical SMILES for CID 134901174 is C=CC(CCCCCCOC1CCCCO1)[Si](C)C.
What is the InChIKey of CID 134901174?
The InChIKey is UYJZUEBRZFXNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31O2Si/c1-4-15(19(2)3)11-7-5-6-9-13-17-16-12-8-10-14-18-16/h4,15-16H,1,5-14H2,2-3H3.
What are the key properties of CID 134901174?
CID 134901174 has a molecular weight of 283.51 g/mol, XLogP of 4.79, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134901174 is sourced from PubChem (CID 134901174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).