C16H32O2Si — CID 134901222
(4R,6S)-4-butyl-2,2-di(propan-2-yl)-6-prop-2-enyl-1,3,2-dioxasilinane (PubChem CID 134901222) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (4R,6S)-4-butyl-2,2-di(propan-2-yl)-6-prop-2-enyl-1,3,2-dioxasilinane.
| Compound Name | (4R,6S)-4-butyl-2,2-di(propan-2-yl)-6-prop-2-enyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 134901222 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (4R,6S)-4-butyl-2,2-di(propan-2-yl)-6-prop-2-enyl-1,3,2-dioxasilinane |
| SMILES | C=CC[C@H]1C[C@@H](CCCC)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C16H32O2Si/c1-7-9-11-16-12-15(10-8-2)17-19(18-16,13(3)4)14(5)6/h8,13-16H,2,7,9-12H2,1,3-6H3/t15-,16+/m0/s1 |
| InChIKey | MLWPWAMXQYBFOM-JKSUJKDBSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|