C22H32O2Si — CID 134901231
2,3-dimethylbutan-2-yl-dimethyl-[(Z)-9-(oxan-2-yloxy)non-3-en-1,5,7-triynyl]silane (PubChem CID 134901231) has the molecular formula C22H32O2Si and a molecular weight of 356.58 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-dimethyl-[(Z)-9-(oxan-2-yloxy)non-3-en-1,5,7-triynyl]silane.
| Compound Name | 2,3-dimethylbutan-2-yl-dimethyl-[(Z)-9-(oxan-2-yloxy)non-3-en-1,5,7-triynyl]silane |
|---|---|
| PubChem CID | 134901231 |
| Molecular Formula | C22H32O2Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-dimethyl-[(Z)-9-(oxan-2-yloxy)non-3-en-1,5,7-triynyl]silane |
| SMILES | CC(C)C(C)(C)[Si](C)(C)C#C/C=C\C#CC#CCOC1CCCCO1 |
| InChI | InChI=1S/C22H32O2Si/c1-20(2)22(3,4)25(5,6)19-15-11-9-7-8-10-13-17-23-21-16-12-14-18-24-21/h9,11,20-21H,12,14,16-18H2,1-6H3/b11-9- |
| InChIKey | DHQKUXPJFOLKHQ-LUAWRHEFSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|