C14H18O3 — CID 134901284
(2R,3aR,4S,5R,6aS)-2-methoxy-4-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol (PubChem CID 134901284) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2R,3aR,4S,5R,6aS)-2-methoxy-4-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol.
| Compound Name | (2R,3aR,4S,5R,6aS)-2-methoxy-4-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
|---|---|
| PubChem CID | 134901284 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2R,3aR,4S,5R,6aS)-2-methoxy-4-phenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-ol |
| SMILES | CO[C@H]1C[C@@H]2[C@@H](c3ccccc3)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C14H18O3/c1-16-13-7-10-12(17-13)8-11(15)14(10)9-5-3-2-4-6-9/h2-6,10-15H,7-8H2,1H3/t10-,11+,12-,13+,14+/m0/s1 |
| InChIKey | WZFZMYYIOBOVNQ-MEBFFEOJSA-N |
| XLogP | 1.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |