About (2R)-2-azidopropan-1-ol
(2R)-2-azidopropan-1-ol (PubChem CID 134901298) has the molecular formula C3H7N3O
and a molecular weight of 101.11 g/mol. Its IUPAC name is (2R)-2-azidopropan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-azidopropan-1-ol |
| PubChem CID | 134901298 |
| Molecular Formula | C3H7N3O |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | (2R)-2-azidopropan-1-ol |
| SMILES | C[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C3H7N3O/c1-3(2-7)5-6-4/h3,7H,2H2,1H3/t3-/m1/s1 |
| InChIKey | RIVUDQMCBGGPRV-GSVOUGTGSA-N |
| XLogP | 0.68 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-azidopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-azidopropan-1-ol?
The IUPAC name of (2R)-2-azidopropan-1-ol (CID 134901298) is (2R)-2-azidopropan-1-ol.
What is the SMILES notation for (2R)-2-azidopropan-1-ol?
The canonical SMILES for (2R)-2-azidopropan-1-ol is C[C@H](CO)N=[N+]=[N-].
What is the InChIKey of (2R)-2-azidopropan-1-ol?
The InChIKey is RIVUDQMCBGGPRV-GSVOUGTGSA-N. The full InChI is InChI=1S/C3H7N3O/c1-3(2-7)5-6-4/h3,7H,2H2,1H3/t3-/m1/s1.
What are the key properties of (2R)-2-azidopropan-1-ol?
(2R)-2-azidopropan-1-ol has a molecular weight of 101.11 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-azidopropan-1-ol is sourced from PubChem (CID 134901298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).