C17H30O2 — CID 134901353
(5R)-2,2,4,4-tetramethyl-5-[(3Z,7E)-3-methylnona-3,7-dienyl]-1,3-dioxolane (PubChem CID 134901353) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (5R)-2,2,4,4-tetramethyl-5-[(3Z,7E)-3-methylnona-3,7-dienyl]-1,3-dioxolane.
| Compound Name | (5R)-2,2,4,4-tetramethyl-5-[(3Z,7E)-3-methylnona-3,7-dienyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 134901353 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (5R)-2,2,4,4-tetramethyl-5-[(3Z,7E)-3-methylnona-3,7-dienyl]-1,3-dioxolane |
| SMILES | C/C=C/CC/C=C(/C)CC[C@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C17H30O2/c1-7-8-9-10-11-14(2)12-13-15-16(3,4)19-17(5,6)18-15/h7-8,11,15H,9-10,12-13H2,1-6H3/b8-7+,14-11-/t15-/m1/s1 |
| InChIKey | BDCPDNASAMLKFG-FICQWJETSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|