About N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide
N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide (PubChem CID 134901409) has the molecular formula C20H27NO3S
and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide |
| PubChem CID | 134901409 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide |
| SMILES | CCCCC[C@H](O)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H27NO3S/c1-3-4-6-11-19(22)20(17-9-7-5-8-10-17)21-25(23,24)18-14-12-16(2)13-15-18/h5,7-10,12-15,19-22H,3-4,6,11H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | AYDXGRTXSPWNTP-VQTJNVASSA-N |
| XLogP | 3.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide (CID 134901409) is N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide is CCCCC[C@H](O)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1.
What is the InChIKey of N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide?
The InChIKey is AYDXGRTXSPWNTP-VQTJNVASSA-N. The full InChI is InChI=1S/C20H27NO3S/c1-3-4-6-11-19(22)20(17-9-7-5-8-10-17)21-25(23,24)18-14-12-16(2)13-15-18/h5,7-10,12-15,19-22H,3-4,6,11H2,1-2H3/t19-,20+/m0/s1.
What are the key properties of N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide?
N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide has a molecular weight of 361.51 g/mol, XLogP of 3.96, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-2-hydroxy-1-phenylheptyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 134901409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).