C16H34O2Si — CID 134901492
2,2-ditert-butyl-5-ethyl-4-propyl-1,3,2-dioxasilinane (PubChem CID 134901492) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is 2,2-ditert-butyl-5-ethyl-4-propyl-1,3,2-dioxasilinane.
| Compound Name | 2,2-ditert-butyl-5-ethyl-4-propyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 134901492 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2,2-ditert-butyl-5-ethyl-4-propyl-1,3,2-dioxasilinane |
| SMILES | CCCC1O[Si](C(C)(C)C)(C(C)(C)C)OCC1CC |
| InChI | InChI=1S/C16H34O2Si/c1-9-11-14-13(10-2)12-17-19(18-14,15(3,4)5)16(6,7)8/h13-14H,9-12H2,1-8H3 |
| InChIKey | VPMMCPLGYZUJHD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|