C28H38O4SSi — CID 134901495
methyl (7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate (PubChem CID 134901495) has the molecular formula C28H38O4SSi and a molecular weight of 498.76 g/mol. Its IUPAC name is methyl (7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate.
| Compound Name | methyl (7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate |
|---|---|
| PubChem CID | 134901495 |
| Molecular Formula | C28H38O4SSi |
| Molecular Weight | 498.76 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | methyl (7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate |
| SMILES | COC(=O)CCCC#C/C=C\C#C[C@@](C)(O[Si](C)(C)C(C)(C)C)/C(=C/CO)Sc1ccccc1 |
| InChI | InChI=1S/C28H38O4SSi/c1-27(2,3)34(6,7)32-28(4,25(21-23-29)33-24-18-14-13-15-19-24)22-17-12-10-8-9-11-16-20-26(30)31-5/h10,12-15,18-19,21,29H,11,16,20,23H2,1-7H3/b12-10-,25-21-/t28-/m1/s1 |
| InChIKey | JWZSBKXPZMORKI-MMYQOJSMSA-N |
| XLogP | 6.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.76 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|